C23H16Cl2N2OS — CID 6048381
(E)-3-(2,6-dichlorophenyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]prop-2-enamide (PubChem CID 6048381) has the molecular formula C23H16Cl2N2OS and a molecular weight of 439.37 g/mol. Its IUPAC name is (E)-3-(2,6-dichlorophenyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,6-dichlorophenyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6048381 |
| Molecular Formula | C23H16Cl2N2OS |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | (E)-3-(2,6-dichlorophenyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)/C=C/c4c(Cl)cccc4Cl)cc3)sc2c1 |
| InChI | InChI=1S/C23H16Cl2N2OS/c1-14-5-11-20-21(13-14)29-23(27-20)15-6-8-16(9-7-15)26-22(28)12-10-17-18(24)3-2-4-19(17)25/h2-13H,1H3,(H,26,28)/b12-10+ |
| InChIKey | HAVXFVCZJKZECX-ZRDIBKRKSA-N |
| XLogP | 7.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|