C26H18ClN3OS2 — CID 17113992
5-chloro-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide (PubChem CID 17113992) has the molecular formula C26H18ClN3OS2 and a molecular weight of 488.04 g/mol. Its IUPAC name is 5-chloro-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | 5-chloro-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 17113992 |
| Molecular Formula | C26H18ClN3OS2 |
| Molecular Weight | 488.04 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 5-chloro-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]naphthalene-1-carboxamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=S)NC(=O)c4cccc5c(Cl)cccc45)cc3)sc2c1 |
| InChI | InChI=1S/C26H18ClN3OS2/c1-15-8-13-22-23(14-15)33-25(29-22)16-9-11-17(12-10-16)28-26(32)30-24(31)20-6-2-5-19-18(20)4-3-7-21(19)27/h2-14H,1H3,(H2,28,30,31,32) |
| InChIKey | DDCFMFAFYXITRW-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.04 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|