C23H18N4O3S — CID 108529403
N'-(2-aminobenzoyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]oxamide (PubChem CID 108529403) has the molecular formula C23H18N4O3S and a molecular weight of 430.49 g/mol. Its IUPAC name is N'-(2-aminobenzoyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]oxamide.
| Compound Name | N'-(2-aminobenzoyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 108529403 |
| Molecular Formula | C23H18N4O3S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N'-(2-aminobenzoyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]oxamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)C(=O)NC(=O)c4ccccc4N)cc3)sc2c1 |
| InChI | InChI=1S/C23H18N4O3S/c1-13-6-11-18-19(12-13)31-23(26-18)14-7-9-15(10-8-14)25-21(29)22(30)27-20(28)16-4-2-3-5-17(16)24/h2-12H,24H2,1H3,(H,25,29)(H,27,28,30) |
| InChIKey | CVQWYTCHVFDJAB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|