C22H18N4O2S — CID 108518396
N'-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-N-(pyridin-2-ylmethyl)oxamide (PubChem CID 108518396) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is N'-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-N-(pyridin-2-ylmethyl)oxamide.
| Compound Name | N'-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-N-(pyridin-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 108518396 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N'-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-N-(pyridin-2-ylmethyl)oxamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)C(=O)NCc4ccccn4)cc3)sc2c1 |
| InChI | InChI=1S/C22H18N4O2S/c1-14-5-10-18-19(12-14)29-22(26-18)15-6-8-16(9-7-15)25-21(28)20(27)24-13-17-4-2-3-11-23-17/h2-12H,13H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | VFHCSMYFCLBXKA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|