C21H23N3O3S — CID 108525845
N-(5-hydroxypentyl)-N'-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]oxamide (PubChem CID 108525845) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-N'-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]oxamide.
| Compound Name | N-(5-hydroxypentyl)-N'-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 108525845 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-(5-hydroxypentyl)-N'-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]oxamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)C(=O)NCCCCCO)cc3)sc2c1 |
| InChI | InChI=1S/C21H23N3O3S/c1-14-5-10-17-18(13-14)28-21(24-17)15-6-8-16(9-7-15)23-20(27)19(26)22-11-3-2-4-12-25/h5-10,13,25H,2-4,11-12H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | FVJZIEWTFNCMNJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|