C25H25N3O2S — CID 108881442
1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-[3-(4-methylphenoxy)propyl]urea (PubChem CID 108881442) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-[3-(4-methylphenoxy)propyl]urea.
| Compound Name | 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-[3-(4-methylphenoxy)propyl]urea |
|---|---|
| PubChem CID | 108881442 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-[3-(4-methylphenoxy)propyl]urea |
| SMILES | Cc1ccc(OCCCNC(=O)Nc2ccc(-c3nc4ccc(C)cc4s3)cc2)cc1 |
| InChI | InChI=1S/C25H25N3O2S/c1-17-4-11-21(12-5-17)30-15-3-14-26-25(29)27-20-9-7-19(8-10-20)24-28-22-13-6-18(2)16-23(22)31-24/h4-13,16H,3,14-15H2,1-2H3,(H2,26,27,29) |
| InChIKey | LHUWQHWNOKENRI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|