C19H21N3OS2 — CID 19687145
1-(3-methoxypropyl)-3-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]thiourea (PubChem CID 19687145) has the molecular formula C19H21N3OS2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]thiourea.
| Compound Name | 1-(3-methoxypropyl)-3-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 19687145 |
| Molecular Formula | C19H21N3OS2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-(3-methoxypropyl)-3-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]thiourea |
| SMILES | COCCCNC(=S)Nc1ccc(-c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C19H21N3OS2/c1-13-4-9-16-17(12-13)25-18(22-16)14-5-7-15(8-6-14)21-19(24)20-10-3-11-23-2/h4-9,12H,3,10-11H2,1-2H3,(H2,20,21,24) |
| InChIKey | WQUSGXYVQHKRSW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|