C30H33N3O2S2 — CID 54784043
5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]pentanamide (PubChem CID 54784043) has the molecular formula C30H33N3O2S2 and a molecular weight of 531.75 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]pentanamide |
|---|---|
| PubChem CID | 54784043 |
| Molecular Formula | C30H33N3O2S2 |
| Molecular Weight | 531.75 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]pentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)NC(=S)Nc2ccc(-c3nc4ccc(C)cc4s3)cc2)c1 |
| InChI | InChI=1S/C30H33N3O2S2/c1-19-7-9-21(3)25(17-19)35-16-6-15-30(4,5)28(34)33-29(36)31-23-12-10-22(11-13-23)27-32-24-14-8-20(2)18-26(24)37-27/h7-14,17-18H,6,15-16H2,1-5H3,(H2,31,33,34,36) |
| InChIKey | BDMXIZRWWNVOTA-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.75 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|