C22H25N3O4S — CID 66491308
2-(3-methoxypropylamino)-4-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-4-oxobutanoic acid (PubChem CID 66491308) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is 2-(3-methoxypropylamino)-4-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-4-oxobutanoic acid.
| Compound Name | 2-(3-methoxypropylamino)-4-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 66491308 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-(3-methoxypropylamino)-4-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-4-oxobutanoic acid |
| SMILES | COCCCNC(CC(=O)Nc1ccc(-c2nc3ccc(C)cc3s2)cc1)C(=O)O |
| InChI | InChI=1S/C22H25N3O4S/c1-14-4-9-17-19(12-14)30-21(25-17)15-5-7-16(8-6-15)24-20(26)13-18(22(27)28)23-10-3-11-29-2/h4-9,12,18,23H,3,10-11,13H2,1-2H3,(H,24,26)(H,27,28) |
| InChIKey | IRBROGPIVUGKNH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|