C25H24N2O2S — CID 9320052
(3R)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-phenoxypentanamide (PubChem CID 9320052) has the molecular formula C25H24N2O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is (3R)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-phenoxypentanamide.
| Compound Name | (3R)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-phenoxypentanamide |
|---|---|
| PubChem CID | 9320052 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | (3R)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-phenoxypentanamide |
| SMILES | CC[C@H](CC(=O)Nc1ccc(-c2nc3ccc(C)cc3s2)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C25H24N2O2S/c1-3-20(29-21-7-5-4-6-8-21)16-24(28)26-19-12-10-18(11-13-19)25-27-22-14-9-17(2)15-23(22)30-25/h4-15,20H,3,16H2,1-2H3,(H,26,28)/t20-/m1/s1 |
| InChIKey | QTALWFDSXNJLSX-HXUWFJFHSA-N |
| XLogP | 6.46 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |