C22H24N4O3S — CID 108522915
2-[4-(2-hydroxyethyl)piperazin-1-yl]-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2-oxoacetamide (PubChem CID 108522915) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethyl)piperazin-1-yl]-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2-oxoacetamide.
| Compound Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108522915 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2-oxoacetamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)C(=O)N4CCN(CCO)CC4)cc3)sc2c1 |
| InChI | InChI=1S/C22H24N4O3S/c1-15-2-7-18-19(14-15)30-21(24-18)16-3-5-17(6-4-16)23-20(28)22(29)26-10-8-25(9-11-26)12-13-27/h2-7,14,27H,8-13H2,1H3,(H,23,28) |
| InChIKey | BIWMNNDOUXMDTE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|