C24H26N4O3S — CID 1023406
(3R)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyrrolidine-2,5-dione (PubChem CID 1023406) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is (3R)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1023406 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | (3R)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)C[C@@H](N5CCN(CCO)CC5)C4=O)cc3)sc2c1 |
| InChI | InChI=1S/C24H26N4O3S/c1-16-2-7-19-21(14-16)32-23(25-19)17-3-5-18(6-4-17)28-22(30)15-20(24(28)31)27-10-8-26(9-11-27)12-13-29/h2-7,14,20,29H,8-13,15H2,1H3/t20-/m1/s1 |
| InChIKey | SMSNAXGJBCDNLY-HXUWFJFHSA-N |
| XLogP | 2.51 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|