C25H27N3O2S — CID 1230638
(3S)-3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyrrolidine-2,5-dione (PubChem CID 1230638) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is (3S)-3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1230638 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (3S)-3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)C[C@H](N5C[C@H](C)C[C@H](C)C5)C4=O)cc3)sc2c1 |
| InChI | InChI=1S/C25H27N3O2S/c1-15-4-9-20-22(11-15)31-24(26-20)18-5-7-19(8-6-18)28-23(29)12-21(25(28)30)27-13-16(2)10-17(3)14-27/h4-9,11,16-17,21H,10,12-14H2,1-3H3/t16-,17+,21-/m0/s1 |
| InChIKey | LIRLVWHOPDYVRL-FVJLSDCUSA-N |
| XLogP | 4.88 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|