C29H28N4O2S — CID 30633686
(3R)-3-(4-benzylpiperazin-1-yl)-1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyrrolidine-2,5-dione (PubChem CID 30633686) has the molecular formula C29H28N4O2S and a molecular weight of 496.64 g/mol. Its IUPAC name is (3R)-3-(4-benzylpiperazin-1-yl)-1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(4-benzylpiperazin-1-yl)-1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 30633686 |
| Molecular Formula | C29H28N4O2S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | (3R)-3-(4-benzylpiperazin-1-yl)-1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)C[C@@H](N5CCN(Cc6ccccc6)CC5)C4=O)cc3)sc2c1 |
| InChI | InChI=1S/C29H28N4O2S/c1-20-7-12-24-26(17-20)36-28(30-24)22-8-10-23(11-9-22)33-27(34)18-25(29(33)35)32-15-13-31(14-16-32)19-21-5-3-2-4-6-21/h2-12,17,25H,13-16,18-19H2,1H3/t25-/m1/s1 |
| InChIKey | RXKNKNGWOZEYSX-RUZDIDTESA-N |
| XLogP | 4.72 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|