C31H24ClN3O4S2 — CID 23914940
N-benzyl-4-chloro-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide (PubChem CID 23914940) has the molecular formula C31H24ClN3O4S2 and a molecular weight of 602.14 g/mol. Its IUPAC name is N-benzyl-4-chloro-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | N-benzyl-4-chloro-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23914940 |
| Molecular Formula | C31H24ClN3O4S2 |
| Molecular Weight | 602.14 g/mol |
| Exact Mass | 601.09 |
| IUPAC Name | N-benzyl-4-chloro-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)CC(N(Cc5ccccc5)S(=O)(=O)c5ccc(Cl)cc5)C4=O)cc3)sc2c1 |
| InChI | InChI=1S/C31H24ClN3O4S2/c1-20-7-16-26-28(17-20)40-30(33-26)22-8-12-24(13-9-22)35-29(36)18-27(31(35)37)34(19-21-5-3-2-4-6-21)41(38,39)25-14-10-23(32)11-15-25/h2-17,27H,18-19H2,1H3 |
| InChIKey | BIJUZAGBDWKQKM-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.14 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|