C33H27N3O4S — CID 23745227
N-benzyl-4-methoxy-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzamide (PubChem CID 23745227) has the molecular formula C33H27N3O4S and a molecular weight of 561.66 g/mol. Its IUPAC name is N-benzyl-4-methoxy-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzamide.
| Compound Name | N-benzyl-4-methoxy-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 23745227 |
| Molecular Formula | C33H27N3O4S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | N-benzyl-4-methoxy-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzamide |
| SMILES | COc1ccc(C(=O)N(Cc2ccccc2)C2CC(=O)N(c3ccc(-c4nc5ccc(C)cc5s4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C33H27N3O4S/c1-21-8-17-27-29(18-21)41-31(34-27)23-9-13-25(14-10-23)36-30(37)19-28(33(36)39)35(20-22-6-4-3-5-7-22)32(38)24-11-15-26(40-2)16-12-24/h3-18,28H,19-20H2,1-2H3 |
| InChIKey | CSTSBFILXBPYSU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|