C30H29N3O3S — CID 23773011
N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)butanamide (PubChem CID 23773011) has the molecular formula C30H29N3O3S and a molecular weight of 511.65 g/mol. Its IUPAC name is N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)butanamide.
| Compound Name | N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 23773011 |
| Molecular Formula | C30H29N3O3S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(2-phenylethyl)butanamide |
| SMILES | CCCC(=O)N(CCc1ccccc1)C1CC(=O)N(c2ccc(-c3nc4ccc(C)cc4s3)cc2)C1=O |
| InChI | InChI=1S/C30H29N3O3S/c1-3-7-27(34)32(17-16-21-8-5-4-6-9-21)25-19-28(35)33(30(25)36)23-13-11-22(12-14-23)29-31-24-15-10-20(2)18-26(24)37-29/h4-6,8-15,18,25H,3,7,16-17,19H2,1-2H3 |
| InChIKey | CLAUHKPQPKNKLE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|