C25H25N3O4S — CID 23970910
N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 23970910) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 23970910 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | CC(=O)N(CC1CCCO1)C1CC(=O)N(c2ccc(-c3nc4ccc(C)cc4s3)cc2)C1=O |
| InChI | InChI=1S/C25H25N3O4S/c1-15-5-10-20-22(12-15)33-24(26-20)17-6-8-18(9-7-17)28-23(30)13-21(25(28)31)27(16(2)29)14-19-4-3-11-32-19/h5-10,12,19,21H,3-4,11,13-14H2,1-2H3 |
| InChIKey | OBIPSUFRJXWRJV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|