C33H33N3O5S — CID 23888409
N-cyclohexyl-3,4-dimethoxy-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzamide (PubChem CID 23888409) has the molecular formula C33H33N3O5S and a molecular weight of 583.71 g/mol. Its IUPAC name is N-cyclohexyl-3,4-dimethoxy-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzamide.
| Compound Name | N-cyclohexyl-3,4-dimethoxy-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 23888409 |
| Molecular Formula | C33H33N3O5S |
| Molecular Weight | 583.71 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | N-cyclohexyl-3,4-dimethoxy-N-[1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]benzamide |
| SMILES | COc1ccc(C(=O)N(C2CCCCC2)C2CC(=O)N(c3ccc(-c4nc5ccc(C)cc5s4)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C33H33N3O5S/c1-20-9-15-25-29(17-20)42-31(34-25)21-10-13-24(14-11-21)36-30(37)19-26(33(36)39)35(23-7-5-4-6-8-23)32(38)22-12-16-27(40-2)28(18-22)41-3/h9-18,23,26H,4-8,19H2,1-3H3 |
| InChIKey | GZZRCVNCDIFULO-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.71 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|