C27H29N3O5 — CID 23972416
N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cycloheptyl-3,4-dimethoxybenzamide (PubChem CID 23972416) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cycloheptyl-3,4-dimethoxybenzamide.
| Compound Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cycloheptyl-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 23972416 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-cycloheptyl-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N(C2CCCCCC2)C2CC(=O)N(c3ccc(C#N)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C27H29N3O5/c1-34-23-14-11-19(15-24(23)35-2)26(32)29(20-7-5-3-4-6-8-20)22-16-25(31)30(27(22)33)21-12-9-18(17-28)10-13-21/h9-15,20,22H,3-8,16H2,1-2H3 |
| InChIKey | KJWXGLFZFYOQFU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 99.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|