C30H26N4O5 — CID 23916419
N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]-3,4-dimethoxybenzamide (PubChem CID 23916419) has the molecular formula C30H26N4O5 and a molecular weight of 522.56 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 23916419 |
| Molecular Formula | C30H26N4O5 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N(CCc2c[nH]c3ccccc23)C2CC(=O)N(c3ccc(C#N)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C30H26N4O5/c1-38-26-12-9-20(15-27(26)39-2)29(36)33(14-13-21-18-32-24-6-4-3-5-23(21)24)25-16-28(35)34(30(25)37)22-10-7-19(17-31)8-11-22/h3-12,15,18,25,32H,13-14,16H2,1-2H3 |
| InChIKey | MDYJDFGWLMZNCB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|