C27H21ClN4O5 — CID 23972582
N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]-4-nitrobenzamide (PubChem CID 23972582) has the molecular formula C27H21ClN4O5 and a molecular weight of 516.94 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]-4-nitrobenzamide.
| Compound Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 23972582 |
| Molecular Formula | C27H21ClN4O5 |
| Molecular Weight | 516.94 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]-4-nitrobenzamide |
| SMILES | O=C1CC(N(CCc2c[nH]c3ccccc23)C(=O)c2ccc([N+](=O)[O-])cc2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H21ClN4O5/c28-19-7-11-20(12-8-19)31-25(33)15-24(27(31)35)30(26(34)17-5-9-21(10-6-17)32(36)37)14-13-18-16-29-23-4-2-1-3-22(18)23/h1-12,16,24,29H,13-15H2 |
| InChIKey | KGJFIZSGOYSXHW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 116.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.94 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|