C29H27N3O3 — CID 23745412
N-[2-(1H-indol-3-yl)ethyl]-4-methyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzamide (PubChem CID 23745412) has the molecular formula C29H27N3O3 and a molecular weight of 465.55 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-4-methyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-4-methyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 23745412 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-4-methyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]benzamide |
| SMILES | Cc1ccc(C(=O)N(CCc2c[nH]c3ccccc23)C2CC(=O)N(c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C29H27N3O3/c1-19-7-11-21(12-8-19)28(34)31(16-15-22-18-30-25-6-4-3-5-24(22)25)26-17-27(33)32(29(26)35)23-13-9-20(2)10-14-23/h3-14,18,26,30H,15-17H2,1-2H3 |
| InChIKey | JGNWGNNBBCMPSF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|