C30H29N3O6 — CID 23860658
N-[2-(1H-indol-3-yl)ethyl]-3,4-dimethoxy-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]benzamide (PubChem CID 23860658) has the molecular formula C30H29N3O6 and a molecular weight of 527.58 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-3,4-dimethoxy-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]benzamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-3,4-dimethoxy-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 23860658 |
| Molecular Formula | C30H29N3O6 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-3,4-dimethoxy-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]benzamide |
| SMILES | COc1ccc(N2C(=O)CC(N(CCc3c[nH]c4ccccc34)C(=O)c3ccc(OC)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C30H29N3O6/c1-37-22-11-9-21(10-12-22)33-28(34)17-25(30(33)36)32(15-14-20-18-31-24-7-5-4-6-23(20)24)29(35)19-8-13-26(38-2)27(16-19)39-3/h4-13,16,18,25,31H,14-15,17H2,1-3H3 |
| InChIKey | ZQUWDOHAYDMQEE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 101.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|