C29H33N3O4 — CID 23915204
N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]cyclohexanecarboxamide (PubChem CID 23915204) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]cyclohexanecarboxamide.
| Compound Name | N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 23915204 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]cyclohexanecarboxamide |
| SMILES | CCOc1ccc(N2C(=O)CC(N(CCc3c[nH]c4ccccc34)C(=O)C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C29H33N3O4/c1-2-36-23-14-12-22(13-15-23)32-27(33)18-26(29(32)35)31(28(34)20-8-4-3-5-9-20)17-16-21-19-30-25-11-7-6-10-24(21)25/h6-7,10-15,19-20,26,30H,2-5,8-9,16-18H2,1H3 |
| InChIKey | ABAXRIXLQSZWRP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|