C28H24FN3O3 — CID 23971007
N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]-2-phenylacetamide (PubChem CID 23971007) has the molecular formula C28H24FN3O3 and a molecular weight of 469.52 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]-2-phenylacetamide.
| Compound Name | N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 23971007 |
| Molecular Formula | C28H24FN3O3 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]-2-phenylacetamide |
| SMILES | O=C1CC(N(CCc2c[nH]c3ccccc23)C(=O)Cc2ccccc2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C28H24FN3O3/c29-21-10-12-22(13-11-21)32-27(34)17-25(28(32)35)31(26(33)16-19-6-2-1-3-7-19)15-14-20-18-30-24-9-5-4-8-23(20)24/h1-13,18,25,30H,14-17H2 |
| InChIKey | ZVPSBRQITPXUBY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|