C26H27N3O4 — CID 23859207
N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]cyclopropanecarboxamide (PubChem CID 23859207) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]cyclopropanecarboxamide.
| Compound Name | N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 23859207 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(1H-indol-3-yl)ethyl]cyclopropanecarboxamide |
| SMILES | CCOc1ccc(N2C(=O)CC(N(CCc3c[nH]c4ccccc34)C(=O)C3CC3)C2=O)cc1 |
| InChI | InChI=1S/C26H27N3O4/c1-2-33-20-11-9-19(10-12-20)29-24(30)15-23(26(29)32)28(25(31)17-7-8-17)14-13-18-16-27-22-6-4-3-5-21(18)22/h3-6,9-12,16-17,23,27H,2,7-8,13-15H2,1H3 |
| InChIKey | CMWTUBAUNZICCA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|