C26H28IN3O3 — CID 23773037
N-[2-(1H-indol-3-yl)ethyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide (PubChem CID 23773037) has the molecular formula C26H28IN3O3 and a molecular weight of 557.43 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 23773037 |
| Molecular Formula | C26H28IN3O3 |
| Molecular Weight | 557.43 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)N(CCc1c[nH]c2ccccc12)C1CC(=O)N(c2ccc(I)cc2)C1=O |
| InChI | InChI=1S/C26H28IN3O3/c1-26(2,3)15-24(32)29(13-12-17-16-28-21-7-5-4-6-20(17)21)22-14-23(31)30(25(22)33)19-10-8-18(27)9-11-19/h4-11,16,22,28H,12-15H2,1-3H3 |
| InChIKey | FOOTUTZHBAGJKN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|