C23H24ClIN2O3 — CID 23802161
N-[(2-chlorophenyl)methyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide (PubChem CID 23802161) has the molecular formula C23H24ClIN2O3 and a molecular weight of 538.81 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 23802161 |
| Molecular Formula | C23H24ClIN2O3 |
| Molecular Weight | 538.81 g/mol |
| Exact Mass | 538.05 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)N(Cc1ccccc1Cl)C1CC(=O)N(c2ccc(I)cc2)C1=O |
| InChI | InChI=1S/C23H24ClIN2O3/c1-23(2,3)13-21(29)26(14-15-6-4-5-7-18(15)24)19-12-20(28)27(22(19)30)17-10-8-16(25)9-11-17/h4-11,19H,12-14H2,1-3H3 |
| InChIKey | CJQNWVDVSGPYTB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.81 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|