C24H27FN2O3 — CID 23802165
N-[(4-fluorophenyl)methyl]-3,3-dimethyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]butanamide (PubChem CID 23802165) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3,3-dimethyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]butanamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3,3-dimethyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 23802165 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3,3-dimethyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]butanamide |
| SMILES | Cc1ccc(N2C(=O)CC(N(Cc3ccc(F)cc3)C(=O)CC(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C24H27FN2O3/c1-16-5-11-19(12-6-16)27-21(28)13-20(23(27)30)26(22(29)14-24(2,3)4)15-17-7-9-18(25)10-8-17/h5-12,20H,13-15H2,1-4H3 |
| InChIKey | HSURZJPOIFXRLE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|