C26H23IN2O3 — CID 23916633
N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methyl-N-[(4-methylphenyl)methyl]benzamide (PubChem CID 23916633) has the molecular formula C26H23IN2O3 and a molecular weight of 538.39 g/mol. Its IUPAC name is N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methyl-N-[(4-methylphenyl)methyl]benzamide.
| Compound Name | N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methyl-N-[(4-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 23916633 |
| Molecular Formula | C26H23IN2O3 |
| Molecular Weight | 538.39 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methyl-N-[(4-methylphenyl)methyl]benzamide |
| SMILES | Cc1ccc(CN(C(=O)c2ccc(C)cc2)C2CC(=O)N(c3ccc(I)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H23IN2O3/c1-17-3-7-19(8-4-17)16-28(25(31)20-9-5-18(2)6-10-20)23-15-24(30)29(26(23)32)22-13-11-21(27)12-14-22/h3-14,23H,15-16H2,1-2H3 |
| InChIKey | BVCVQBWDJHHDFO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|