C28H26N2O6 — CID 23803634
N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methylbenzamide (PubChem CID 23803634) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methylbenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 23803634 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-4-methylbenzamide |
| SMILES | CCOc1ccc(N2C(=O)CC(N(Cc3ccc4c(c3)OCO4)C(=O)c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C28H26N2O6/c1-3-34-22-11-9-21(10-12-22)30-26(31)15-23(28(30)33)29(27(32)20-7-4-18(2)5-8-20)16-19-6-13-24-25(14-19)36-17-35-24/h4-14,23H,3,15-17H2,1-2H3 |
| InChIKey | BXBOTUDBMZARPV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|