C28H30N2O8 — CID 25246575
(E)-4-[1,3-benzodioxol-5-ylmethyl-[1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-4-oxobut-2-enoic acid (PubChem CID 25246575) has the molecular formula C28H30N2O8 and a molecular weight of 522.55 g/mol. Its IUPAC name is (E)-4-[1,3-benzodioxol-5-ylmethyl-[1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[1,3-benzodioxol-5-ylmethyl-[1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 25246575 |
| Molecular Formula | C28H30N2O8 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | (E)-4-[1,3-benzodioxol-5-ylmethyl-[1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-4-oxobut-2-enoic acid |
| SMILES | CCCCCCOc1ccc(N2C(=O)CC(N(Cc3ccc4c(c3)OCO4)C(=O)/C=C/C(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C28H30N2O8/c1-2-3-4-5-14-36-21-9-7-20(8-10-21)30-26(32)16-22(28(30)35)29(25(31)12-13-27(33)34)17-19-6-11-23-24(15-19)38-18-37-23/h6-13,15,22H,2-5,14,16-18H2,1H3,(H,33,34)/b13-12+ |
| InChIKey | ZRVQUTZIPSKQDD-OUKQBFOZSA-N |
| XLogP | 3.68 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|