C24H24N2O7 — CID 40657099
(E)-4-[[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-methoxyphenyl)ethyl]amino]-4-oxobut-2-enoic acid (PubChem CID 40657099) has the molecular formula C24H24N2O7 and a molecular weight of 452.46 g/mol. Its IUPAC name is (E)-4-[[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-methoxyphenyl)ethyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-methoxyphenyl)ethyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 40657099 |
| Molecular Formula | C24H24N2O7 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | (E)-4-[[(3S)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-[2-(4-methoxyphenyl)ethyl]amino]-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(CCN(C(=O)/C=C/C(=O)O)[C@H]2CC(=O)N(c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H24N2O7/c1-32-18-7-3-16(4-8-18)13-14-25(21(27)11-12-23(29)30)20-15-22(28)26(24(20)31)17-5-9-19(33-2)10-6-17/h3-12,20H,13-15H2,1-2H3,(H,29,30)/b12-11+/t20-/m0/s1 |
| InChIKey | MTMLUUYDUPIGJD-SGWGQVFISA-N |
| XLogP | 2.05 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|