C22H19FN2O6 — CID 1042400
(E)-4-[[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-[(4-methoxyphenyl)methyl]amino]-4-oxobut-2-enoic acid (PubChem CID 1042400) has the molecular formula C22H19FN2O6 and a molecular weight of 426.40 g/mol. Its IUPAC name is (E)-4-[[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-[(4-methoxyphenyl)methyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-[(4-methoxyphenyl)methyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 1042400 |
| Molecular Formula | C22H19FN2O6 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (E)-4-[[(3R)-1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-[(4-methoxyphenyl)methyl]amino]-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(CN(C(=O)/C=C/C(=O)O)[C@@H]2CC(=O)N(c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H19FN2O6/c1-31-17-8-2-14(3-9-17)13-24(19(26)10-11-21(28)29)18-12-20(27)25(22(18)30)16-6-4-15(23)5-7-16/h2-11,18H,12-13H2,1H3,(H,28,29)/b11-10+/t18-/m1/s1 |
| InChIKey | UBQVOOMFHXNJRI-DOJUMQAQSA-N |
| XLogP | 2.14 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|