C25H26N2O8 — CID 98202419
(Z)-4-[2-(3,4-dimethoxyphenyl)ethyl-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-4-oxobut-2-enoic acid (PubChem CID 98202419) has the molecular formula C25H26N2O8 and a molecular weight of 482.49 g/mol. Its IUPAC name is (Z)-4-[2-(3,4-dimethoxyphenyl)ethyl-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[2-(3,4-dimethoxyphenyl)ethyl-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 98202419 |
| Molecular Formula | C25H26N2O8 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | (Z)-4-[2-(3,4-dimethoxyphenyl)ethyl-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(N2C(=O)C[C@@H](N(CCc3ccc(OC)c(OC)c3)C(=O)/C=C\C(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C25H26N2O8/c1-33-18-7-5-17(6-8-18)27-23(29)15-19(25(27)32)26(22(28)10-11-24(30)31)13-12-16-4-9-20(34-2)21(14-16)35-3/h4-11,14,19H,12-13,15H2,1-3H3,(H,30,31)/b11-10-/t19-/m1/s1 |
| InChIKey | UOIMZSOAPOTYFG-OEIFXAAASA-N |
| XLogP | 2.06 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|