C26H28N2O8 — CID 2866845
4-[2-(3,4-dimethoxyphenyl)ethyl-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-4-oxobut-2-enoic acid (PubChem CID 2866845) has the molecular formula C26H28N2O8 and a molecular weight of 496.52 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxyphenyl)ethyl-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[2-(3,4-dimethoxyphenyl)ethyl-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 2866845 |
| Molecular Formula | C26H28N2O8 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 4-[2-(3,4-dimethoxyphenyl)ethyl-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-4-oxobut-2-enoic acid |
| SMILES | CCOc1ccc(N2C(=O)CC(N(CCc3ccc(OC)c(OC)c3)C(=O)C=CC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C26H28N2O8/c1-4-36-19-8-6-18(7-9-19)28-24(30)16-20(26(28)33)27(23(29)11-12-25(31)32)14-13-17-5-10-21(34-2)22(15-17)35-3/h5-12,15,20H,4,13-14,16H2,1-3H3,(H,31,32) |
| InChIKey | OPCCAMZLETYAOD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|