C30H32N2O6 — CID 23888600
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-methylbenzamide (PubChem CID 23888600) has the molecular formula C30H32N2O6 and a molecular weight of 516.59 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-methylbenzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 23888600 |
| Molecular Formula | C30H32N2O6 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-methylbenzamide |
| SMILES | CCOc1ccc(N2C(=O)CC(N(CCc3ccc(OC)c(OC)c3)C(=O)c3cccc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C30H32N2O6/c1-5-38-24-12-10-23(11-13-24)32-28(33)19-25(30(32)35)31(29(34)22-8-6-7-20(2)17-22)16-15-21-9-14-26(36-3)27(18-21)37-4/h6-14,17-18,25H,5,15-16,19H2,1-4H3 |
| InChIKey | VSQIXUBWDSLXIL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|