C27H30N2O4 — CID 23860842
N-[2-(cyclohexen-1-yl)ethyl]-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-methylbenzamide (PubChem CID 23860842) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-methylbenzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 23860842 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-3-methylbenzamide |
| SMILES | COc1ccc(N2C(=O)CC(N(CCC3=CCCCC3)C(=O)c3cccc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C27H30N2O4/c1-19-7-6-10-21(17-19)26(31)28(16-15-20-8-4-3-5-9-20)24-18-25(30)29(27(24)32)22-11-13-23(33-2)14-12-22/h6-8,10-14,17,24H,3-5,9,15-16,18H2,1-2H3 |
| InChIKey | YXDSAKXVWFCEFW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|