C26H28N2O3 — CID 23972636
N-[2-(cyclohexen-1-yl)ethyl]-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-4-methylbenzamide (PubChem CID 23972636) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-4-methylbenzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-4-methylbenzamide |
|---|---|
| PubChem CID | 23972636 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N(CCC2=CCCCC2)C2CC(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C26H28N2O3/c1-19-12-14-21(15-13-19)25(30)27(17-16-20-8-4-2-5-9-20)23-18-24(29)28(26(23)31)22-10-6-3-7-11-22/h3,6-8,10-15,23H,2,4-5,9,16-18H2,1H3 |
| InChIKey | WKHLSHAQEAKYJK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|