C26H30N2O3S — CID 23998954
N-[2-(cyclohexen-1-yl)ethyl]-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]thiophene-2-carboxamide (PubChem CID 23998954) has the molecular formula C26H30N2O3S and a molecular weight of 450.60 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 23998954 |
| Molecular Formula | C26H30N2O3S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]thiophene-2-carboxamide |
| SMILES | CC(C)c1ccc(N2C(=O)CC(N(CCC3=CCCCC3)C(=O)c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C26H30N2O3S/c1-18(2)20-10-12-21(13-11-20)28-24(29)17-22(25(28)30)27(26(31)23-9-6-16-32-23)15-14-19-7-4-3-5-8-19/h6-7,9-13,16,18,22H,3-5,8,14-15,17H2,1-2H3 |
| InChIKey | PLCMOFNLMKWNEG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|