C18H15IN2O3S — CID 23859389
N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enylthiophene-2-carboxamide (PubChem CID 23859389) has the molecular formula C18H15IN2O3S and a molecular weight of 466.30 g/mol. Its IUPAC name is N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enylthiophene-2-carboxamide.
| Compound Name | N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 23859389 |
| Molecular Formula | C18H15IN2O3S |
| Molecular Weight | 466.30 g/mol |
| Exact Mass | 465.98 |
| IUPAC Name | N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]-N-prop-2-enylthiophene-2-carboxamide |
| SMILES | C=CCN(C(=O)c1cccs1)C1CC(=O)N(c2ccc(I)cc2)C1=O |
| InChI | InChI=1S/C18H15IN2O3S/c1-2-9-20(18(24)15-4-3-10-25-15)14-11-16(22)21(17(14)23)13-7-5-12(19)6-8-13/h2-8,10,14H,1,9,11H2 |
| InChIKey | ATKAAWBDFJQEBV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|