C19H19IN2O5S — CID 23915257
N-(2,2-dimethoxyethyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-carboxamide (PubChem CID 23915257) has the molecular formula C19H19IN2O5S and a molecular weight of 514.34 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 23915257 |
| Molecular Formula | C19H19IN2O5S |
| Molecular Weight | 514.34 g/mol |
| Exact Mass | 514.01 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-carboxamide |
| SMILES | COC(CN(C(=O)c1cccs1)C1CC(=O)N(c2ccc(I)cc2)C1=O)OC |
| InChI | InChI=1S/C19H19IN2O5S/c1-26-17(27-2)11-21(19(25)15-4-3-9-28-15)14-10-16(23)22(18(14)24)13-7-5-12(20)6-8-13/h3-9,14,17H,10-11H2,1-2H3 |
| InChIKey | GATSKNRPXABBEP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|