C22H29FN2O5 — CID 23803703
N-(2,2-dimethoxyethyl)-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-2,2,3,3-tetramethylcyclopropane-1-carboxamide (PubChem CID 23803703) has the molecular formula C22H29FN2O5 and a molecular weight of 420.48 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-2,2,3,3-tetramethylcyclopropane-1-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-2,2,3,3-tetramethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 23803703 |
| Molecular Formula | C22H29FN2O5 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-2,2,3,3-tetramethylcyclopropane-1-carboxamide |
| SMILES | COC(CN(C(=O)C1C(C)(C)C1(C)C)C1CC(=O)N(c2ccc(F)cc2)C1=O)OC |
| InChI | InChI=1S/C22H29FN2O5/c1-21(2)18(22(21,3)4)20(28)24(12-17(29-5)30-6)15-11-16(26)25(19(15)27)14-9-7-13(23)8-10-14/h7-10,15,17-18H,11-12H2,1-6H3 |
| InChIKey | UVXRSVIYGAKKAY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|