C20H24N2O7 — CID 23830850
methyl 4-[3-[cyclopropanecarbonyl(2,2-dimethoxyethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23830850) has the molecular formula C20H24N2O7 and a molecular weight of 404.42 g/mol. Its IUPAC name is methyl 4-[3-[cyclopropanecarbonyl(2,2-dimethoxyethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[3-[cyclopropanecarbonyl(2,2-dimethoxyethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23830850 |
| Molecular Formula | C20H24N2O7 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | methyl 4-[3-[cyclopropanecarbonyl(2,2-dimethoxyethyl)amino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)CC(N(CC(OC)OC)C(=O)C3CC3)C2=O)cc1 |
| InChI | InChI=1S/C20H24N2O7/c1-27-17(28-2)11-21(18(24)12-4-5-12)15-10-16(23)22(19(15)25)14-8-6-13(7-9-14)20(26)29-3/h6-9,12,15,17H,4-5,10-11H2,1-3H3 |
| InChIKey | FDQUKBHUUMSLNO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|