C21H21FN2O5 — CID 23832321
N-(2,2-dimethoxyethyl)-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-4-fluorobenzamide (PubChem CID 23832321) has the molecular formula C21H21FN2O5 and a molecular weight of 400.41 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-4-fluorobenzamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 23832321 |
| Molecular Formula | C21H21FN2O5 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-4-fluorobenzamide |
| SMILES | COC(CN(C(=O)c1ccc(F)cc1)C1CC(=O)N(c2ccccc2)C1=O)OC |
| InChI | InChI=1S/C21H21FN2O5/c1-28-19(29-2)13-23(20(26)14-8-10-15(22)11-9-14)17-12-18(25)24(21(17)27)16-6-4-3-5-7-16/h3-11,17,19H,12-13H2,1-2H3 |
| InChIKey | WJPJFFWMASKJTC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|