C26H22FN3O6 — CID 3318387
N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxy-N'-(2-phenoxyacetyl)benzohydrazide (PubChem CID 3318387) has the molecular formula C26H22FN3O6 and a molecular weight of 491.48 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxy-N'-(2-phenoxyacetyl)benzohydrazide.
| Compound Name | N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxy-N'-(2-phenoxyacetyl)benzohydrazide |
|---|---|
| PubChem CID | 3318387 |
| Molecular Formula | C26H22FN3O6 |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-4-methoxy-N'-(2-phenoxyacetyl)benzohydrazide |
| SMILES | COc1ccc(C(=O)N(NC(=O)COc2ccccc2)C2CC(=O)N(c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H22FN3O6/c1-35-20-13-7-17(8-14-20)25(33)30(28-23(31)16-36-21-5-3-2-4-6-21)22-15-24(32)29(26(22)34)19-11-9-18(27)10-12-19/h2-14,22H,15-16H2,1H3,(H,28,31) |
| InChIKey | ORQDSDXYNRYXIV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|