C24H26ClN3O6 — CID 3288072
N'-[2-(4-chlorophenoxy)acetyl]-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-methylbutanehydrazide (PubChem CID 3288072) has the molecular formula C24H26ClN3O6 and a molecular weight of 487.94 g/mol. Its IUPAC name is N'-[2-(4-chlorophenoxy)acetyl]-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-methylbutanehydrazide.
| Compound Name | N'-[2-(4-chlorophenoxy)acetyl]-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-methylbutanehydrazide |
|---|---|
| PubChem CID | 3288072 |
| Molecular Formula | C24H26ClN3O6 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | N'-[2-(4-chlorophenoxy)acetyl]-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-methylbutanehydrazide |
| SMILES | CCC(C)C(=O)N(NC(=O)COc1ccc(Cl)cc1)C1CC(=O)N(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C24H26ClN3O6/c1-4-15(2)23(31)28(26-21(29)14-34-19-9-5-16(25)6-10-19)20-13-22(30)27(24(20)32)17-7-11-18(33-3)12-8-17/h5-12,15,20H,4,13-14H2,1-3H3,(H,26,29) |
| InChIKey | AZOXXGUSIHGOEH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|