C23H24N4O7 — CID 4528874
N'-[1-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-methylbutanoyl)-2-nitrobenzohydrazide (PubChem CID 4528874) has the molecular formula C23H24N4O7 and a molecular weight of 468.47 g/mol. Its IUPAC name is N'-[1-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-methylbutanoyl)-2-nitrobenzohydrazide.
| Compound Name | N'-[1-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-methylbutanoyl)-2-nitrobenzohydrazide |
|---|---|
| PubChem CID | 4528874 |
| Molecular Formula | C23H24N4O7 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | N'-[1-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-N'-(2-methylbutanoyl)-2-nitrobenzohydrazide |
| SMILES | CCC(C)C(=O)N(NC(=O)c1ccccc1[N+](=O)[O-])C1CC(=O)N(c2cccc(OC)c2)C1=O |
| InChI | InChI=1S/C23H24N4O7/c1-4-14(2)22(30)26(24-21(29)17-10-5-6-11-18(17)27(32)33)19-13-20(28)25(23(19)31)15-8-7-9-16(12-15)34-3/h5-12,14,19H,4,13H2,1-3H3,(H,24,29) |
| InChIKey | JDINKBPGAVQDDU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|