C21H21N3O6 — CID 4590585
ethyl N-[benzoyl-[1-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]carbamate (PubChem CID 4590585) has the molecular formula C21H21N3O6 and a molecular weight of 411.41 g/mol. Its IUPAC name is ethyl N-[benzoyl-[1-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]carbamate.
| Compound Name | ethyl N-[benzoyl-[1-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]carbamate |
|---|---|
| PubChem CID | 4590585 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | ethyl N-[benzoyl-[1-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino]carbamate |
| SMILES | CCOC(=O)NN(C(=O)c1ccccc1)C1CC(=O)N(c2cccc(OC)c2)C1=O |
| InChI | InChI=1S/C21H21N3O6/c1-3-30-21(28)22-24(19(26)14-8-5-4-6-9-14)17-13-18(25)23(20(17)27)15-10-7-11-16(12-15)29-2/h4-12,17H,3,13H2,1-2H3,(H,22,28) |
| InChIKey | ZAYOPHBEKCGAET-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|